Organic acids and derivatives
Filtered Search Results
Terephthalic Dihydrazide, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 136-64-1
| CAS | 136-64-1 |
|---|
| Optical Rotation | [α]/D -28°C ± 2°C = 0.1 in. H218O |
|---|---|
| Percent Purity | ≥92% (HPLC) |
| Linear Formula | C10D3H14NO6 · xLi+ |
| CAS | 1803252-71-2 (Free Acid) |
| Flash Point | Not applicable |
| Grade | Analytical Standard |
| Recommended Storage | -20°C |
| Shelf Life | Limited shelf life, expiry date on the label |
| Molecular Formula | C10D3H14NO6 · xLi+ |
| Formula Weight | 250.26 (Free Acid Basis) |
Isobutyric anhydride, 97%
CAS: 97-72-3 Molecular Formula: C8H14O3 Molecular Weight (g/mol): 158.2 MDL Number: MFCD00008913 InChI Key: LSACYLWPPQLVSM-UHFFFAOYSA-N Synonym: isobutyric anhydride,isobutyric acid anhydride,propanoic acid, 2-methyl-, anhydride,2-methylpropanoic anhydride,isobutyricanhydride,isobutyryl anhydride,2-methylpropionic anhydride,unii-n85a80fjdt,n85a80fjdt,2-methylpropanoic acid anhydride PubChem CID: 7346 ChEBI: CHEBI:84261 IUPAC Name: 2-methylpropanoyl 2-methylpropanoate SMILES: CC(C)C(=O)OC(=O)C(C)C
| PubChem CID | 7346 |
|---|---|
| CAS | 97-72-3 |
| Molecular Weight (g/mol) | 158.2 |
| ChEBI | CHEBI:84261 |
| MDL Number | MFCD00008913 |
| SMILES | CC(C)C(=O)OC(=O)C(C)C |
| Synonym | isobutyric anhydride,isobutyric acid anhydride,propanoic acid, 2-methyl-, anhydride,2-methylpropanoic anhydride,isobutyricanhydride,isobutyryl anhydride,2-methylpropionic anhydride,unii-n85a80fjdt,n85a80fjdt,2-methylpropanoic acid anhydride |
| IUPAC Name | 2-methylpropanoyl 2-methylpropanoate |
| InChI Key | LSACYLWPPQLVSM-UHFFFAOYSA-N |
| Molecular Formula | C8H14O3 |
2,2,2-Trifluoro-N-methylacetamide, 98%
CAS: 815-06-5 Molecular Formula: C3H4F3NO Molecular Weight (g/mol): 127.066 MDL Number: MFCD00009670 InChI Key: IQNHBUQSOSYAJU-UHFFFAOYSA-N Synonym: n-methyltrifluoroacetamide,n-methyl-2,2,2-trifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl,2,2,2-trifluoro-n-methyl-acetamide,n-metnyl-2,2,2-trifluoroacetamide,methyltrifluoroacetamide,acmc-209plm,n-methyl-trifluoroacetamide,n-methyltrifluoro-acetamide PubChem CID: 69948 IUPAC Name: 2,2,2-trifluoro-N-methylacetamide SMILES: CNC(=O)C(F)(F)F
| PubChem CID | 69948 |
|---|---|
| CAS | 815-06-5 |
| Molecular Weight (g/mol) | 127.066 |
| MDL Number | MFCD00009670 |
| SMILES | CNC(=O)C(F)(F)F |
| Synonym | n-methyltrifluoroacetamide,n-methyl-2,2,2-trifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl,2,2,2-trifluoro-n-methyl-acetamide,n-metnyl-2,2,2-trifluoroacetamide,methyltrifluoroacetamide,acmc-209plm,n-methyl-trifluoroacetamide,n-methyltrifluoro-acetamide |
| IUPAC Name | 2,2,2-trifluoro-N-methylacetamide |
| InChI Key | IQNHBUQSOSYAJU-UHFFFAOYSA-N |
| Molecular Formula | C3H4F3NO |
2,2,3,3,4,4,4-Heptafluorobutyl acrylate, 97%, stab. with 100 ppm 4-methoxyphenol
CAS: 424-64-6 Molecular Formula: C7H5F7O2 Molecular Weight (g/mol): 254.104 MDL Number: MFCD00039252 InChI Key: PLXOUIVCSUBZIX-UHFFFAOYSA-N Synonym: 1h,1h-heptafluorobutyl acrylate,2,2,3,3,4,4,4-heptafluorobutyl acrylate,heptafluorobutyl acrylate,2-propenoic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,2,2,3,3,4,4,4-heptafluorobutyl acrylate, stab. with 100 ppm 4-methoxyphenol,1h, 1h-heptafluorobutylacrylate,1,1-dihydroheptafluorobutyl acrylate,1h,1h-heptafluorobut-1-yl acrylat,2,2,3,3,4,4,4-heptafluorobutyl=propenoate PubChem CID: 67923 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutyl prop-2-enoate SMILES: C=CC(=O)OCC(C(C(F)(F)F)(F)F)(F)F
| PubChem CID | 67923 |
|---|---|
| CAS | 424-64-6 |
| Molecular Weight (g/mol) | 254.104 |
| MDL Number | MFCD00039252 |
| SMILES | C=CC(=O)OCC(C(C(F)(F)F)(F)F)(F)F |
| Synonym | 1h,1h-heptafluorobutyl acrylate,2,2,3,3,4,4,4-heptafluorobutyl acrylate,heptafluorobutyl acrylate,2-propenoic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,2,2,3,3,4,4,4-heptafluorobutyl acrylate, stab. with 100 ppm 4-methoxyphenol,1h, 1h-heptafluorobutylacrylate,1,1-dihydroheptafluorobutyl acrylate,1h,1h-heptafluorobut-1-yl acrylat,2,2,3,3,4,4,4-heptafluorobutyl=propenoate |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl prop-2-enoate |
| InChI Key | PLXOUIVCSUBZIX-UHFFFAOYSA-N |
| Molecular Formula | C7H5F7O2 |
Zinc propionate, 97%
CAS: 557-28-8 Molecular Formula: C6H10O4Zn Molecular Weight (g/mol): 211.52 MDL Number: MFCD00045937 InChI Key: XDWXRAYGALQIFG-UHFFFAOYSA-L Synonym: zinc propionate,unii-81pxa87xvc,81pxa87xvc,propanoic acid, zinc salt 2:1,gyna-plex,propionic acid, zinc salt,zinc dipropionate,propanoic acid, zinc salt,zinc propanoate,propanoic acid, zinc salt, basic PubChem CID: 11189 IUPAC Name: zinc;propanoate SMILES: [Zn++].CCC([O-])=O.CCC([O-])=O
| PubChem CID | 11189 |
|---|---|
| CAS | 557-28-8 |
| Molecular Weight (g/mol) | 211.52 |
| MDL Number | MFCD00045937 |
| SMILES | [Zn++].CCC([O-])=O.CCC([O-])=O |
| Synonym | zinc propionate,unii-81pxa87xvc,81pxa87xvc,propanoic acid, zinc salt 2:1,gyna-plex,propionic acid, zinc salt,zinc dipropionate,propanoic acid, zinc salt,zinc propanoate,propanoic acid, zinc salt, basic |
| IUPAC Name | zinc;propanoate |
| InChI Key | XDWXRAYGALQIFG-UHFFFAOYSA-L |
| Molecular Formula | C6H10O4Zn |
| CAS | 2309-07-1 |
|---|---|
| MDL Number | MFCD00017208 |
6-chloronicotinamide, 98%, Thermo Scientific™
CAS: 6271-78-9 Molecular Formula: C6H5ClN2O Molecular Weight (g/mol): 156.57 MDL Number: MFCD00006242 InChI Key: ZIJAZUBWHAZHPL-UHFFFAOYSA-N Synonym: 6-chloronicotinamide,3-pyridinecarboxamide, 6-chloro,nicotinamide, 6-chloro,6-chloro-3-pyridinecarboxamide,6-chloro-nicotinamide,acmc-1b4gd,6-chloronicotinic acid amide,3-carbamoyl-6-chloropyridine,ksc492o5t PubChem CID: 80456 IUPAC Name: 6-chloropyridine-3-carboxamide SMILES: NC(=O)C1=CC=C(Cl)N=C1
| PubChem CID | 80456 |
|---|---|
| CAS | 6271-78-9 |
| Molecular Weight (g/mol) | 156.57 |
| MDL Number | MFCD00006242 |
| SMILES | NC(=O)C1=CC=C(Cl)N=C1 |
| Synonym | 6-chloronicotinamide,3-pyridinecarboxamide, 6-chloro,nicotinamide, 6-chloro,6-chloro-3-pyridinecarboxamide,6-chloro-nicotinamide,acmc-1b4gd,6-chloronicotinic acid amide,3-carbamoyl-6-chloropyridine,ksc492o5t |
| IUPAC Name | 6-chloropyridine-3-carboxamide |
| InChI Key | ZIJAZUBWHAZHPL-UHFFFAOYSA-N |
| Molecular Formula | C6H5ClN2O |
Pyridine-3-boronic acid, 95%
CAS: 1692-25-7 Molecular Formula: C5H6BNO2 Molecular Weight (g/mol): 122.92 MDL Number: MFCD00674177 InChI Key: ABMYEXAYWZJVOV-UHFFFAOYSA-N Synonym: pyridine-3-boronic acid,3-pyridylboronic acid,3-pyridineboronic acid,pyridin-3-yl boronic acid,3-pyridinylboronic acid,pyridin-3-yl-3-boronic acid,3-pyridineboric acid,3-pyridinebornic acid,pyridyl-3-boronic acid,pyridine 3-boronic acid PubChem CID: 2734378 SMILES: OB(O)C1=CC=CN=C1
| PubChem CID | 2734378 |
|---|---|
| CAS | 1692-25-7 |
| Molecular Weight (g/mol) | 122.92 |
| MDL Number | MFCD00674177 |
| SMILES | OB(O)C1=CC=CN=C1 |
| Synonym | pyridine-3-boronic acid,3-pyridylboronic acid,3-pyridineboronic acid,pyridin-3-yl boronic acid,3-pyridinylboronic acid,pyridin-3-yl-3-boronic acid,3-pyridineboric acid,3-pyridinebornic acid,pyridyl-3-boronic acid,pyridine 3-boronic acid |
| InChI Key | ABMYEXAYWZJVOV-UHFFFAOYSA-N |
| Molecular Formula | C5H6BNO2 |
4-Nitrobenzhydrazide, 98+%
CAS: 636-97-5 Molecular Formula: C7H7N3O3 Molecular Weight (g/mol): 181.151 MDL Number: MFCD00007604 InChI Key: FKZXYJYTUSGIQE-UHFFFAOYSA-N Synonym: 4-nitrobenzhydrazide,p-nitrobenzhydrazide,4-nitrobenzoylhydrazine,p-nitrobenzohydrazide,p-nitrobenzoylhydrazide,p-nitrobenzoic hydrazide,p-nitrobenzoic acid hydrazide,p-nitrobenzoyl hydrazine,4-nitrobenzoic acid hydrazide,4-nitrobenzoyl hydrazide PubChem CID: 3693744 ChEBI: CHEBI:66928 IUPAC Name: 4-nitrobenzohydrazide SMILES: C1=CC(=CC=C1C(=O)NN)[N+](=O)[O-]
| PubChem CID | 3693744 |
|---|---|
| CAS | 636-97-5 |
| Molecular Weight (g/mol) | 181.151 |
| ChEBI | CHEBI:66928 |
| MDL Number | MFCD00007604 |
| SMILES | C1=CC(=CC=C1C(=O)NN)[N+](=O)[O-] |
| Synonym | 4-nitrobenzhydrazide,p-nitrobenzhydrazide,4-nitrobenzoylhydrazine,p-nitrobenzohydrazide,p-nitrobenzoylhydrazide,p-nitrobenzoic hydrazide,p-nitrobenzoic acid hydrazide,p-nitrobenzoyl hydrazine,4-nitrobenzoic acid hydrazide,4-nitrobenzoyl hydrazide |
| IUPAC Name | 4-nitrobenzohydrazide |
| InChI Key | FKZXYJYTUSGIQE-UHFFFAOYSA-N |
| Molecular Formula | C7H7N3O3 |
Sodium glycolate, 97%
CAS: 2836-32-0 Molecular Formula: C2H3NaO3 Molecular Weight (g/mol): 98.033 MDL Number: MFCD00065358 InChI Key: VILMUCRZVVVJCA-UHFFFAOYSA-M Synonym: sodium glycolate,sodium hydroxyacetate,sodium 2-hydroxyacetate,sodium lycolate,monosodium glycolate,glycolic acid sodium salt,natriumglykolat,sodium glycollate,acetic acid, hydroxy-, monosodium salt,glycolic acid, monosodium salt PubChem CID: 517347 IUPAC Name: sodium;2-hydroxyacetate SMILES: C(C(=O)[O-])O.[Na+]
| PubChem CID | 517347 |
|---|---|
| CAS | 2836-32-0 |
| Molecular Weight (g/mol) | 98.033 |
| MDL Number | MFCD00065358 |
| SMILES | C(C(=O)[O-])O.[Na+] |
| Synonym | sodium glycolate,sodium hydroxyacetate,sodium 2-hydroxyacetate,sodium lycolate,monosodium glycolate,glycolic acid sodium salt,natriumglykolat,sodium glycollate,acetic acid, hydroxy-, monosodium salt,glycolic acid, monosodium salt |
| IUPAC Name | sodium;2-hydroxyacetate |
| InChI Key | VILMUCRZVVVJCA-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO3 |
Ethyl 2-methyl-4-pentenoate, 98%
CAS: 53399-81-8 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.20 MDL Number: MFCD00010235 InChI Key: BDBGKYIBDXAVMX-UHFFFAOYNA-N Synonym: ethyl 2-methyl-4-pentenoate,2-methyl-4-pentenoic acid ethyl ester,ethyl 2-methyl 4-pentenoate,4-pentenoic acid, 2-methyl-, ethyl ester,ethyl 2-methylpent-4-en-1-oate,ethyl 2-methyl-4-pentanoate,fema no. 3489,pineapple pentenoate,acmc-1ao14,ethyl-2-methyl-4-pentenoate PubChem CID: 62024 IUPAC Name: ethyl 2-methylpent-4-enoate SMILES: CCOC(=O)C(C)CC=C
| PubChem CID | 62024 |
|---|---|
| CAS | 53399-81-8 |
| Molecular Weight (g/mol) | 142.20 |
| MDL Number | MFCD00010235 |
| SMILES | CCOC(=O)C(C)CC=C |
| Synonym | ethyl 2-methyl-4-pentenoate,2-methyl-4-pentenoic acid ethyl ester,ethyl 2-methyl 4-pentenoate,4-pentenoic acid, 2-methyl-, ethyl ester,ethyl 2-methylpent-4-en-1-oate,ethyl 2-methyl-4-pentanoate,fema no. 3489,pineapple pentenoate,acmc-1ao14,ethyl-2-methyl-4-pentenoate |
| IUPAC Name | ethyl 2-methylpent-4-enoate |
| InChI Key | BDBGKYIBDXAVMX-UHFFFAOYNA-N |
| Molecular Formula | C8H14O2 |
Iron(III) citrate hydrate, 98%
CAS: 334024-15-6 Molecular Formula: C6H5FeO7 Molecular Weight (g/mol): 244.94 MDL Number: MFCD00149615 InChI Key: NPFOYSMITVOQOS-UHFFFAOYSA-K Synonym: ferric citrate monohydrate,iron iii citrate hydrate,unii-334s8t6lke,ferric citrate hydrate,ferric citrate usan,iron iii citrate tribasic monohydrate,citric acid iron iii salt,iron cento citrate hydrate,ksc534c4h,iron 3+ citrate hydrate PubChem CID: 22178220 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylate;iron(3+);hydrate SMILES: [Fe+3].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
| PubChem CID | 22178220 |
|---|---|
| CAS | 334024-15-6 |
| Molecular Weight (g/mol) | 244.94 |
| MDL Number | MFCD00149615 |
| SMILES | [Fe+3].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| Synonym | ferric citrate monohydrate,iron iii citrate hydrate,unii-334s8t6lke,ferric citrate hydrate,ferric citrate usan,iron iii citrate tribasic monohydrate,citric acid iron iii salt,iron cento citrate hydrate,ksc534c4h,iron 3+ citrate hydrate |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylate;iron(3+);hydrate |
| InChI Key | NPFOYSMITVOQOS-UHFFFAOYSA-K |
| Molecular Formula | C6H5FeO7 |
1,2,3,5-Tetra-O-benzoyl-2-C-methyl-beta-D-ribofuranose, 98%, Thermo Scientific Chemicals
CAS: 15397-15-6 Molecular Formula: C34H28O9 Molecular Weight (g/mol): 580.589 MDL Number: MFCD07369658 InChI Key: QJZSLTLDMBDKOU-VBHQRPIPSA-N Synonym: 1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-b-d-ribofuranose,2s,3r,4r,5r-5-benzoyloxy methyl-3-methyltetrahydrofuran-2,3,4-triyl tribenzoate,2s,3r,4r,5r-2,4-bis benzoyloxy-5-benzoyloxy methyl-3-methyloxolan-3-yl benzoate,1,2,3,5-tetra-o-benzoyl-2'-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d ribofuranose,2-c-methyl-beta-d-ribofuranose 1,2,3,5-tetrabenzoate,2-c-methyl-1,2,3,5-tetra-o-benzoyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofura PubChem CID: 10875560 IUPAC Name: [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate SMILES: CC1(C(C(OC1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5
| PubChem CID | 10875560 |
|---|---|
| CAS | 15397-15-6 |
| Molecular Weight (g/mol) | 580.589 |
| MDL Number | MFCD07369658 |
| SMILES | CC1(C(C(OC1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
| Synonym | 1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-b-d-ribofuranose,2s,3r,4r,5r-5-benzoyloxy methyl-3-methyltetrahydrofuran-2,3,4-triyl tribenzoate,2s,3r,4r,5r-2,4-bis benzoyloxy-5-benzoyloxy methyl-3-methyloxolan-3-yl benzoate,1,2,3,5-tetra-o-benzoyl-2'-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d ribofuranose,2-c-methyl-beta-d-ribofuranose 1,2,3,5-tetrabenzoate,2-c-methyl-1,2,3,5-tetra-o-benzoyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofura |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
| InChI Key | QJZSLTLDMBDKOU-VBHQRPIPSA-N |
| Molecular Formula | C34H28O9 |
Citric acid, trilithium salt tetrahydrate, 98%, pure, Thermo Scientific Chemicals
CAS: 6080-58-6 MDL Number: MFCD00150030 InChI Key: HXGWMCJZLNWEBC-UHFFFAOYSA-K Synonym: lithium citrate tetrahydrate,unii-5z6e9k79yv,trilithium citrate tetrahydrate,lithium citrate usp,citric acid trilithium salt tetrahydrate,tri-lithium citrate tetrahydrate,lithium citrate tribasic tetrahydrate,lithonate tn,1,2,3-propanetricarboxylic acid, 2-hydroxy-trilithium salt tetrahydrate PubChem CID: 2724118 ChEBI: CHEBI:64754 IUPAC Name: trilithium;2-hydroxypropane-1,2,3-tricarboxylate;tetrahydrate SMILES: [Li+].[Li+].[Li+].C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.O
| PubChem CID | 2724118 |
|---|---|
| CAS | 6080-58-6 |
| ChEBI | CHEBI:64754 |
| MDL Number | MFCD00150030 |
| SMILES | [Li+].[Li+].[Li+].C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.O |
| Synonym | lithium citrate tetrahydrate,unii-5z6e9k79yv,trilithium citrate tetrahydrate,lithium citrate usp,citric acid trilithium salt tetrahydrate,tri-lithium citrate tetrahydrate,lithium citrate tribasic tetrahydrate,lithonate tn,1,2,3-propanetricarboxylic acid, 2-hydroxy-trilithium salt tetrahydrate |
| IUPAC Name | trilithium;2-hydroxypropane-1,2,3-tricarboxylate;tetrahydrate |
| InChI Key | HXGWMCJZLNWEBC-UHFFFAOYSA-K |